C23H18O2 — CID 102499485
(1S,2R)-2-[2-(6-methoxynaphthalen-1-yl)ethynyl]-1,2-dihydronaphthalen-1-ol (PubChem CID 102499485) has the molecular formula C23H18O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (1S,2R)-2-[2-(6-methoxynaphthalen-1-yl)ethynyl]-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1S,2R)-2-[2-(6-methoxynaphthalen-1-yl)ethynyl]-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 102499485 |
| Molecular Formula | C23H18O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (1S,2R)-2-[2-(6-methoxynaphthalen-1-yl)ethynyl]-1,2-dihydronaphthalen-1-ol |
| SMILES | COc1ccc2c(C#C[C@H]3C=Cc4ccccc4[C@H]3O)cccc2c1 |
| InChI | InChI=1S/C23H18O2/c1-25-20-13-14-21-16(6-4-7-19(21)15-20)9-11-18-12-10-17-5-2-3-8-22(17)23(18)24/h2-8,10,12-15,18,23-24H,1H3/t18-,23-/m0/s1 |
| InChIKey | ZKFHTLBJZWGTOU-MBSDFSHPSA-N |
| XLogP | 4.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|