C25H14O4 — CID 102500026
spiro[1,3-dihydrocyclopenta[a]anthracene-2,2'-indene]-1',3',6,11-tetrone (PubChem CID 102500026) has the molecular formula C25H14O4 and a molecular weight of 378.38 g/mol. Its IUPAC name is spiro[1,3-dihydrocyclopenta[a]anthracene-2,2'-indene]-1',3',6,11-tetrone.
| Compound Name | spiro[1,3-dihydrocyclopenta[a]anthracene-2,2'-indene]-1',3',6,11-tetrone |
|---|---|
| PubChem CID | 102500026 |
| Molecular Formula | C25H14O4 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | spiro[1,3-dihydrocyclopenta[a]anthracene-2,2'-indene]-1',3',6,11-tetrone |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1c2CC2(C1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H14O4/c26-21-14-5-1-2-6-15(14)22(27)20-18(21)10-9-13-11-25(12-19(13)20)23(28)16-7-3-4-8-17(16)24(25)29/h1-10H,11-12H2 |
| InChIKey | GYUVITPIFMPXTI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|