C19H16O3 — CID 132987765
(2R)-2-hydroxy-2-methyl-3,4-dihydro-1H-benzo[a]anthracene-7,12-dione (PubChem CID 132987765) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-methyl-3,4-dihydro-1H-benzo[a]anthracene-7,12-dione.
| Compound Name | (2R)-2-hydroxy-2-methyl-3,4-dihydro-1H-benzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 132987765 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (2R)-2-hydroxy-2-methyl-3,4-dihydro-1H-benzo[a]anthracene-7,12-dione |
| SMILES | C[C@@]1(O)CCc2ccc3c(c2C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C19H16O3/c1-19(22)9-8-11-6-7-14-16(15(11)10-19)18(21)13-5-3-2-4-12(13)17(14)20/h2-7,22H,8-10H2,1H3/t19-/m1/s1 |
| InChIKey | SIJURHHKUFYDRK-LJQANCHMSA-N |
| XLogP | 2.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|