C26H35NO4S — CID 102502484
[(2S,6S)-3-(butylamino)-2-phenylmethoxy-4-(4-propan-2-ylphenyl)sulfinyl-3,6-dihydro-2H-pyran-6-yl]methanol (PubChem CID 102502484) has the molecular formula C26H35NO4S and a molecular weight of 457.64 g/mol. Its IUPAC name is [(2S,6S)-3-(butylamino)-2-phenylmethoxy-4-(4-propan-2-ylphenyl)sulfinyl-3,6-dihydro-2H-pyran-6-yl]methanol.
| Compound Name | [(2S,6S)-3-(butylamino)-2-phenylmethoxy-4-(4-propan-2-ylphenyl)sulfinyl-3,6-dihydro-2H-pyran-6-yl]methanol |
|---|---|
| PubChem CID | 102502484 |
| Molecular Formula | C26H35NO4S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | [(2S,6S)-3-(butylamino)-2-phenylmethoxy-4-(4-propan-2-ylphenyl)sulfinyl-3,6-dihydro-2H-pyran-6-yl]methanol |
| SMILES | CCCCNC1C(S(=O)c2ccc(C(C)C)cc2)=C[C@@H](CO)O[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H35NO4S/c1-4-5-15-27-25-24(32(29)23-13-11-21(12-14-23)19(2)3)16-22(17-28)31-26(25)30-18-20-9-7-6-8-10-20/h6-14,16,19,22,25-28H,4-5,15,17-18H2,1-3H3/t22-,25?,26-,32?/m0/s1 |
| InChIKey | ASWGZPYSEGCQBY-XGODAXKBSA-N |
| XLogP | 4.49 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|