C41H50O7S — CID 46211763
[(2R,3R,4S,5R,6S)-6-(4-octoxyphenyl)sulfinyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 46211763) has the molecular formula C41H50O7S and a molecular weight of 686.91 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-(4-octoxyphenyl)sulfinyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R,6S)-6-(4-octoxyphenyl)sulfinyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 46211763 |
| Molecular Formula | C41H50O7S |
| Molecular Weight | 686.91 g/mol |
| Exact Mass | 686.33 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-(4-octoxyphenyl)sulfinyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CCCCCCCCOc1ccc(S(=O)[C@@H]2O[C@H](CO)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C41H50O7S/c1-2-3-4-5-6-16-27-44-35-23-25-36(26-24-35)49(43)41-40(47-31-34-21-14-9-15-22-34)39(46-30-33-19-12-8-13-20-33)38(37(28-42)48-41)45-29-32-17-10-7-11-18-32/h7-15,17-26,37-42H,2-6,16,27-31H2,1H3/t37-,38-,39+,40-,41+,49?/m1/s1 |
| InChIKey | HTJVOUAPEVCNLU-UTNZUPSMSA-N |
| XLogP | 8.01 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.91 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|