C16H33F2O5P — CID 102506222
[(3R)-1,1-difluoro-3,4-dihexoxybutyl]phosphonic acid (PubChem CID 102506222) has the molecular formula C16H33F2O5P and a molecular weight of 374.41 g/mol. Its IUPAC name is [(3R)-1,1-difluoro-3,4-dihexoxybutyl]phosphonic acid.
| Compound Name | [(3R)-1,1-difluoro-3,4-dihexoxybutyl]phosphonic acid |
|---|---|
| PubChem CID | 102506222 |
| Molecular Formula | C16H33F2O5P |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | [(3R)-1,1-difluoro-3,4-dihexoxybutyl]phosphonic acid |
| SMILES | CCCCCCOC[C@@H](CC(F)(F)P(=O)(O)O)OCCCCCC |
| InChI | InChI=1S/C16H33F2O5P/c1-3-5-7-9-11-22-14-15(23-12-10-8-6-4-2)13-16(17,18)24(19,20)21/h15H,3-14H2,1-2H3,(H2,19,20,21)/t15-/m1/s1 |
| InChIKey | BHSPLSNVNPCXBW-OAHLLOKOSA-N |
| XLogP | 4.71 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|