C26H22N4O5 — CID 102508493
4-(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)-2-(4-nitrophenyl)-5-phenyl-1H-pyrazol-3-one (PubChem CID 102508493) has the molecular formula C26H22N4O5 and a molecular weight of 470.49 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)-2-(4-nitrophenyl)-5-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)-2-(4-nitrophenyl)-5-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 102508493 |
| Molecular Formula | C26H22N4O5 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 4-(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)-2-(4-nitrophenyl)-5-phenyl-1H-pyrazol-3-one |
| SMILES | COc1cc2c(cc1OC)C(c1c(-c3ccccc3)[nH]n(-c3ccc([N+](=O)[O-])cc3)c1=O)=NCC2 |
| InChI | InChI=1S/C26H22N4O5/c1-34-21-14-17-12-13-27-25(20(17)15-22(21)35-2)23-24(16-6-4-3-5-7-16)28-29(26(23)31)18-8-10-19(11-9-18)30(32)33/h3-11,14-15,28H,12-13H2,1-2H3 |
| InChIKey | XHGVUCYLEJTJGY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|