C19H15NO — CID 102509565
(2S,3R)-3-hydroxy-2-naphthalen-1-yl-3-phenylpropanenitrile (PubChem CID 102509565) has the molecular formula C19H15NO and a molecular weight of 273.34 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-naphthalen-1-yl-3-phenylpropanenitrile.
| Compound Name | (2S,3R)-3-hydroxy-2-naphthalen-1-yl-3-phenylpropanenitrile |
|---|---|
| PubChem CID | 102509565 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-naphthalen-1-yl-3-phenylpropanenitrile |
| SMILES | N#C[C@H](c1cccc2ccccc12)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H15NO/c20-13-18(19(21)15-8-2-1-3-9-15)17-12-6-10-14-7-4-5-11-16(14)17/h1-12,18-19,21H/t18-,19+/m1/s1 |
| InChIKey | OXKQCXACCGZGTI-MOPGFXCFSA-N |
| XLogP | 4.18 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |