C20H21NO5 — CID 102511956
benzhydryl (2R)-2-(5-hydroxy-3-oxooxazinan-2-yl)propanoate (PubChem CID 102511956) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is benzhydryl (2R)-2-(5-hydroxy-3-oxooxazinan-2-yl)propanoate.
| Compound Name | benzhydryl (2R)-2-(5-hydroxy-3-oxooxazinan-2-yl)propanoate |
|---|---|
| PubChem CID | 102511956 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | benzhydryl (2R)-2-(5-hydroxy-3-oxooxazinan-2-yl)propanoate |
| SMILES | C[C@H](C(=O)OC(c1ccccc1)c1ccccc1)N1OCC(O)CC1=O |
| InChI | InChI=1S/C20H21NO5/c1-14(21-18(23)12-17(22)13-25-21)20(24)26-19(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14,17,19,22H,12-13H2,1H3/t14-,17?/m1/s1 |
| InChIKey | CHXDNVAUNMRZST-XPCCGILXSA-N |
| XLogP | 2.23 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |