C18H32ClNO5S — CID 102514651
ethyl (2S,3R)-4-(chloromethyl)-3-cyclohexyl-2-[(2-methylpropan-2-yl)oxysulfonylamino]pent-4-enoate (PubChem CID 102514651) has the molecular formula C18H32ClNO5S and a molecular weight of 409.98 g/mol. Its IUPAC name is ethyl (2S,3R)-4-(chloromethyl)-3-cyclohexyl-2-[(2-methylpropan-2-yl)oxysulfonylamino]pent-4-enoate.
| Compound Name | ethyl (2S,3R)-4-(chloromethyl)-3-cyclohexyl-2-[(2-methylpropan-2-yl)oxysulfonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 102514651 |
| Molecular Formula | C18H32ClNO5S |
| Molecular Weight | 409.98 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | ethyl (2S,3R)-4-(chloromethyl)-3-cyclohexyl-2-[(2-methylpropan-2-yl)oxysulfonylamino]pent-4-enoate |
| SMILES | C=C(CCl)[C@@H](C1CCCCC1)[C@H](NS(=O)(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C18H32ClNO5S/c1-6-24-17(21)16(20-26(22,23)25-18(3,4)5)15(13(2)12-19)14-10-8-7-9-11-14/h14-16,20H,2,6-12H2,1,3-5H3/t15-,16-/m0/s1 |
| InChIKey | INGDFMFBORXVCA-HOTGVXAUSA-N |
| XLogP | 3.56 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.98 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|