C23H35NO3S — CID 11661407
ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]-3-cyclohexyl-4-phenylpent-4-enoate (PubChem CID 11661407) has the molecular formula C23H35NO3S and a molecular weight of 405.60 g/mol. Its IUPAC name is ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]-3-cyclohexyl-4-phenylpent-4-enoate.
| Compound Name | ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]-3-cyclohexyl-4-phenylpent-4-enoate |
|---|---|
| PubChem CID | 11661407 |
| Molecular Formula | C23H35NO3S |
| Molecular Weight | 405.60 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]-3-cyclohexyl-4-phenylpent-4-enoate |
| SMILES | C=C(c1ccccc1)C(C1CCCCC1)[C@@H](N[S@](=O)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C23H35NO3S/c1-6-27-22(25)21(24-28(26)23(3,4)5)20(19-15-11-8-12-16-19)17(2)18-13-9-7-10-14-18/h7,9-10,13-14,19-21,24H,2,6,8,11-12,15-16H2,1,3-5H3/t20?,21-,28-/m1/s1 |
| InChIKey | VBSIPBQEQUHHQX-XRDBWGCYSA-N |
| XLogP | 4.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |