C19H32O6S2 — CID 10251585
(4R,5S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4S,5R)-5-(1,3-dithian-2-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10251585) has the molecular formula C19H32O6S2 and a molecular weight of 420.59 g/mol. Its IUPAC name is (4R,5S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4S,5R)-5-(1,3-dithian-2-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4S,5R)-5-(1,3-dithian-2-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10251585 |
| Molecular Formula | C19H32O6S2 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (4R,5S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4S,5R)-5-(1,3-dithian-2-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)O[C@H]([C@@H]2OC(C)(C)O[C@H]2C2SCCCS2)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C19H32O6S2/c1-17(2)20-10-11(21-17)12-13(23-18(3,4)22-12)14-15(25-19(5,6)24-14)16-26-8-7-9-27-16/h11-16H,7-10H2,1-6H3/t11-,12-,13+,14+,15-/m1/s1 |
| InChIKey | DQSYCOUEMUIIAA-NIFZNCRKSA-N |
| XLogP | 3.37 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |