C32H39NO7S — CID 102517578
1-[7-(4,4-dimethyl-3-oxopentyl)-6-(4-methylphenyl)sulfonyl-2,3-dihydro-[1,4]dioxino[2,3-f]indol-8-yl]-5,5-dimethylhexane-1,4-dione (PubChem CID 102517578) has the molecular formula C32H39NO7S and a molecular weight of 581.73 g/mol. Its IUPAC name is 1-[7-(4,4-dimethyl-3-oxopentyl)-6-(4-methylphenyl)sulfonyl-2,3-dihydro-[1,4]dioxino[2,3-f]indol-8-yl]-5,5-dimethylhexane-1,4-dione.
| Compound Name | 1-[7-(4,4-dimethyl-3-oxopentyl)-6-(4-methylphenyl)sulfonyl-2,3-dihydro-[1,4]dioxino[2,3-f]indol-8-yl]-5,5-dimethylhexane-1,4-dione |
|---|---|
| PubChem CID | 102517578 |
| Molecular Formula | C32H39NO7S |
| Molecular Weight | 581.73 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 1-[7-(4,4-dimethyl-3-oxopentyl)-6-(4-methylphenyl)sulfonyl-2,3-dihydro-[1,4]dioxino[2,3-f]indol-8-yl]-5,5-dimethylhexane-1,4-dione |
| SMILES | Cc1ccc(S(=O)(=O)n2c(CCC(=O)C(C)(C)C)c(C(=O)CCC(=O)C(C)(C)C)c3cc4c(cc32)OCCO4)cc1 |
| InChI | InChI=1S/C32H39NO7S/c1-20-8-10-21(11-9-20)41(37,38)33-23(12-14-28(35)31(2,3)4)30(25(34)13-15-29(36)32(5,6)7)22-18-26-27(19-24(22)33)40-17-16-39-26/h8-11,18-19H,12-17H2,1-7H3 |
| InChIKey | OVAVKPVFJJECHR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 108.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.73 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |