C21H22FNO4S — CID 161490684
5-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylphenyl)sulfonylindol-3-yl]pentan-2-one (PubChem CID 161490684) has the molecular formula C21H22FNO4S and a molecular weight of 403.48 g/mol. Its IUPAC name is 5-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylphenyl)sulfonylindol-3-yl]pentan-2-one.
| Compound Name | 5-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylphenyl)sulfonylindol-3-yl]pentan-2-one |
|---|---|
| PubChem CID | 161490684 |
| Molecular Formula | C21H22FNO4S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 5-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylphenyl)sulfonylindol-3-yl]pentan-2-one |
| SMILES | CC(=O)CCCc1c(C)n(S(=O)(=O)c2ccc(C)cc2)c2cc(F)c(O)cc12 |
| InChI | InChI=1S/C21H22FNO4S/c1-13-7-9-16(10-8-13)28(26,27)23-15(3)17(6-4-5-14(2)24)18-11-21(25)19(22)12-20(18)23/h7-12,25H,4-6H2,1-3H3 |
| InChIKey | WFOJMXPJLQRQSW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |