C21H23FN2O3S — CID 159825175
4-[6-fluoro-5-methyl-1-(4-methylphenyl)sulfonylindol-3-yl]-N-methylbutanamide (PubChem CID 159825175) has the molecular formula C21H23FN2O3S and a molecular weight of 402.49 g/mol. Its IUPAC name is 4-[6-fluoro-5-methyl-1-(4-methylphenyl)sulfonylindol-3-yl]-N-methylbutanamide.
| Compound Name | 4-[6-fluoro-5-methyl-1-(4-methylphenyl)sulfonylindol-3-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 159825175 |
| Molecular Formula | C21H23FN2O3S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 4-[6-fluoro-5-methyl-1-(4-methylphenyl)sulfonylindol-3-yl]-N-methylbutanamide |
| SMILES | CNC(=O)CCCc1cn(S(=O)(=O)c2ccc(C)cc2)c2cc(F)c(C)cc12 |
| InChI | InChI=1S/C21H23FN2O3S/c1-14-7-9-17(10-8-14)28(26,27)24-13-16(5-4-6-21(25)23-3)18-11-15(2)19(22)12-20(18)24/h7-13H,4-6H2,1-3H3,(H,23,25) |
| InChIKey | NMSZSOQKZQMXCT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |