C27H29NO3S2 — CID 86221058
5-(benzenesulfinyl)-3-hexyl-1-(4-methylphenyl)sulfonylindole (PubChem CID 86221058) has the molecular formula C27H29NO3S2 and a molecular weight of 479.67 g/mol. Its IUPAC name is 5-(benzenesulfinyl)-3-hexyl-1-(4-methylphenyl)sulfonylindole.
| Compound Name | 5-(benzenesulfinyl)-3-hexyl-1-(4-methylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 86221058 |
| Molecular Formula | C27H29NO3S2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 5-(benzenesulfinyl)-3-hexyl-1-(4-methylphenyl)sulfonylindole |
| SMILES | CCCCCCc1cn(S(=O)(=O)c2ccc(C)cc2)c2ccc(S(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C27H29NO3S2/c1-3-4-5-7-10-22-20-28(33(30,31)25-16-13-21(2)14-17-25)27-18-15-24(19-26(22)27)32(29)23-11-8-6-9-12-23/h6,8-9,11-20H,3-5,7,10H2,1-2H3 |
| InChIKey | VDLJRICVQWXPJB-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|