C24H28FN3O6S — CID 122698086
methyl N-[2-[3-(2-acetamidoethyl)-6-fluoro-2-methyl-1-(4-methylphenyl)sulfonylindol-5-yl]oxyethyl]carbamate (PubChem CID 122698086) has the molecular formula C24H28FN3O6S and a molecular weight of 505.57 g/mol. Its IUPAC name is methyl N-[2-[3-(2-acetamidoethyl)-6-fluoro-2-methyl-1-(4-methylphenyl)sulfonylindol-5-yl]oxyethyl]carbamate.
| Compound Name | methyl N-[2-[3-(2-acetamidoethyl)-6-fluoro-2-methyl-1-(4-methylphenyl)sulfonylindol-5-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 122698086 |
| Molecular Formula | C24H28FN3O6S |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | methyl N-[2-[3-(2-acetamidoethyl)-6-fluoro-2-methyl-1-(4-methylphenyl)sulfonylindol-5-yl]oxyethyl]carbamate |
| SMILES | COC(=O)NCCOc1cc2c(CCNC(C)=O)c(C)n(S(=O)(=O)c3ccc(C)cc3)c2cc1F |
| InChI | InChI=1S/C24H28FN3O6S/c1-15-5-7-18(8-6-15)35(31,32)28-16(2)19(9-10-26-17(3)29)20-13-23(21(25)14-22(20)28)34-12-11-27-24(30)33-4/h5-8,13-14H,9-12H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | FCBLRAKPWYLICT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|