C24H23NO6S2 — CID 102520307
methyl (2R,3S,4S,5S)-3,4-bis(benzenesulfonyl)-5-phenylpyrrolidine-2-carboxylate (PubChem CID 102520307) has the molecular formula C24H23NO6S2 and a molecular weight of 485.58 g/mol. Its IUPAC name is methyl (2R,3S,4S,5S)-3,4-bis(benzenesulfonyl)-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,3S,4S,5S)-3,4-bis(benzenesulfonyl)-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102520307 |
| Molecular Formula | C24H23NO6S2 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | methyl (2R,3S,4S,5S)-3,4-bis(benzenesulfonyl)-5-phenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@@H](c2ccccc2)[C@H](S(=O)(=O)c2ccccc2)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23NO6S2/c1-31-24(26)21-23(33(29,30)19-15-9-4-10-16-19)22(20(25-21)17-11-5-2-6-12-17)32(27,28)18-13-7-3-8-14-18/h2-16,20-23,25H,1H3/t20-,21-,22-,23-/m0/s1 |
| InChIKey | BESINLODQCOZRE-MLCQCVOFSA-N |
| XLogP | 2.56 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |