C17H16FNO4S — CID 19709500
4-(benzenesulfonyl)-5-(2-fluorophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 19709500) has the molecular formula C17H16FNO4S and a molecular weight of 349.38 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-5-(2-fluorophenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 4-(benzenesulfonyl)-5-(2-fluorophenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 19709500 |
| Molecular Formula | C17H16FNO4S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 4-(benzenesulfonyl)-5-(2-fluorophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(S(=O)(=O)c2ccccc2)C(c2ccccc2F)N1 |
| InChI | InChI=1S/C17H16FNO4S/c18-13-9-5-4-8-12(13)16-15(10-14(19-16)17(20)21)24(22,23)11-6-2-1-3-7-11/h1-9,14-16,19H,10H2,(H,20,21) |
| InChIKey | IAAFMSQBKMDBNF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |