C17H15F2NO4S — CID 19700378
5-(2-fluorophenyl)-4-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 19700378) has the molecular formula C17H15F2NO4S and a molecular weight of 367.37 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-4-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | 5-(2-fluorophenyl)-4-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 19700378 |
| Molecular Formula | C17H15F2NO4S |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 5-(2-fluorophenyl)-4-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(S(=O)(=O)c2ccccc2F)C(c2ccccc2F)N1 |
| InChI | InChI=1S/C17H15F2NO4S/c18-11-6-2-1-5-10(11)16-15(9-13(20-16)17(21)22)25(23,24)14-8-4-3-7-12(14)19/h1-8,13,15-16,20H,9H2,(H,21,22) |
| InChIKey | HSUUMYFVGOPELQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |