C12H14FNO4S — CID 19700420
5-(2-fluorophenyl)-4-methylsulfonylpyrrolidine-2-carboxylic acid (PubChem CID 19700420) has the molecular formula C12H14FNO4S and a molecular weight of 287.31 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-4-methylsulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | 5-(2-fluorophenyl)-4-methylsulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 19700420 |
| Molecular Formula | C12H14FNO4S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-(2-fluorophenyl)-4-methylsulfonylpyrrolidine-2-carboxylic acid |
| SMILES | CS(=O)(=O)C1CC(C(=O)O)NC1c1ccccc1F |
| InChI | InChI=1S/C12H14FNO4S/c1-19(17,18)10-6-9(12(15)16)14-11(10)7-4-2-3-5-8(7)13/h2-5,9-11,14H,6H2,1H3,(H,15,16) |
| InChIKey | LWGVDKXHXRWLAN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |