C17H15FNO4S- — CID 19709499
4-(benzenesulfonyl)-5-(2-fluorophenyl)pyrrolidine-2-carboxylate (PubChem CID 19709499) has the molecular formula C17H15FNO4S- and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-5-(2-fluorophenyl)pyrrolidine-2-carboxylate.
| Compound Name | 4-(benzenesulfonyl)-5-(2-fluorophenyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 19709499 |
| Molecular Formula | C17H15FNO4S- |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 4-(benzenesulfonyl)-5-(2-fluorophenyl)pyrrolidine-2-carboxylate |
| SMILES | O=C([O-])C1CC(S(=O)(=O)c2ccccc2)C(c2ccccc2F)N1 |
| InChI | InChI=1S/C17H16FNO4S/c18-13-9-5-4-8-12(13)16-15(10-14(19-16)17(20)21)24(22,23)11-6-2-1-3-7-11/h1-9,14-16,19H,10H2,(H,20,21)/p-1 |
| InChIKey | IAAFMSQBKMDBNF-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |