C24H23ClFNO4S — CID 139692984
benzyl 4-(benzenesulfonyl)-5-(2-fluorophenyl)pyrrolidine-2-carboxylate;hydrochloride (PubChem CID 139692984) has the molecular formula C24H23ClFNO4S and a molecular weight of 475.97 g/mol. Its IUPAC name is benzyl 4-(benzenesulfonyl)-5-(2-fluorophenyl)pyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | benzyl 4-(benzenesulfonyl)-5-(2-fluorophenyl)pyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 139692984 |
| Molecular Formula | C24H23ClFNO4S |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | benzyl 4-(benzenesulfonyl)-5-(2-fluorophenyl)pyrrolidine-2-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCc1ccccc1)C1CC(S(=O)(=O)c2ccccc2)C(c2ccccc2F)N1 |
| InChI | InChI=1S/C24H22FNO4S.ClH/c25-20-14-8-7-13-19(20)23-22(31(28,29)18-11-5-2-6-12-18)15-21(26-23)24(27)30-16-17-9-3-1-4-10-17;/h1-14,21-23,26H,15-16H2;1H |
| InChIKey | CFZLWRDTHNOYKI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |