C14H13ClO6S-2 — CID 11921533
(1R,2S,4S,5S)-4-(benzenesulfonyl)-5-chlorocyclohexane-1,2-dicarboxylate (PubChem CID 11921533) has the molecular formula C14H13ClO6S-2 and a molecular weight of 344.77 g/mol. Its IUPAC name is (1R,2S,4S,5S)-4-(benzenesulfonyl)-5-chlorocyclohexane-1,2-dicarboxylate.
| Compound Name | (1R,2S,4S,5S)-4-(benzenesulfonyl)-5-chlorocyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11921533 |
| Molecular Formula | C14H13ClO6S-2 |
| Molecular Weight | 344.77 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | (1R,2S,4S,5S)-4-(benzenesulfonyl)-5-chlorocyclohexane-1,2-dicarboxylate |
| SMILES | O=C([O-])[C@H]1C[C@H](S(=O)(=O)c2ccccc2)[C@@H](Cl)C[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C14H15ClO6S/c15-11-6-9(13(16)17)10(14(18)19)7-12(11)22(20,21)8-4-2-1-3-5-8/h1-5,9-12H,6-7H2,(H,16,17)(H,18,19)/p-2/t9-,10+,11+,12+/m1/s1 |
| InChIKey | NMWKXOFBFYQBTR-RHYQMDGZSA-L |
| XLogP | -1.04 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.77 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|