(3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid

C11H13NO4S — CID 97184046

IUPAC(3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)[C@@H]1CNC[C@@H]1S(=O)(=O)c1ccccc1
InChIInChI=1S/C11H13NO4S/c13-11(14)9-6-12-7-10(9)17(15,16)8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)/t9-,10+/m1/s1
InChIKeyVAJXRGPYRSZGMT-ZJUUUORDSA-N
MW255.29 g/mol
LogP0.13
Rot. Bonds3

About (3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid

(3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid (PubChem CID 97184046) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is (3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name(3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid
PubChem CID97184046
Molecular FormulaC11H13NO4S
Molecular Weight255.29 g/mol
Exact Mass255.06
IUPAC Name(3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)[C@@H]1CNC[C@@H]1S(=O)(=O)c1ccccc1
InChIInChI=1S/C11H13NO4S/c13-11(14)9-6-12-7-10(9)17(15,16)8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)/t9-,10+/m1/s1
InChIKeyVAJXRGPYRSZGMT-ZJUUUORDSA-N
XLogP0.13
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.29
LogP ≤ 50.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of (3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid (CID 97184046) is (3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for (3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for (3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid is O=C(O)[C@@H]1CNC[C@@H]1S(=O)(=O)c1ccccc1.
What is the InChIKey of (3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid?
The InChIKey is VAJXRGPYRSZGMT-ZJUUUORDSA-N. The full InChI is InChI=1S/C11H13NO4S/c13-11(14)9-6-12-7-10(9)17(15,16)8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)/t9-,10+/m1/s1.
What are the key properties of (3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid?
(3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid has a molecular weight of 255.29 g/mol, XLogP of 0.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-4-(benzenesulfonyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 97184046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).