C22H22F3N3O3 — CID 10252284
2-[[1-(2,6-dimethylphenyl)-3-(3,3,3-trifluoropropyl)pyrazol-5-yl]amino]-5-methoxybenzoic acid (PubChem CID 10252284) has the molecular formula C22H22F3N3O3 and a molecular weight of 433.43 g/mol. Its IUPAC name is 2-[[1-(2,6-dimethylphenyl)-3-(3,3,3-trifluoropropyl)pyrazol-5-yl]amino]-5-methoxybenzoic acid.
| Compound Name | 2-[[1-(2,6-dimethylphenyl)-3-(3,3,3-trifluoropropyl)pyrazol-5-yl]amino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 10252284 |
| Molecular Formula | C22H22F3N3O3 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2-[[1-(2,6-dimethylphenyl)-3-(3,3,3-trifluoropropyl)pyrazol-5-yl]amino]-5-methoxybenzoic acid |
| SMILES | COc1ccc(Nc2cc(CCC(F)(F)F)nn2-c2c(C)cccc2C)c(C(=O)O)c1 |
| InChI | InChI=1S/C22H22F3N3O3/c1-13-5-4-6-14(2)20(13)28-19(11-15(27-28)9-10-22(23,24)25)26-18-8-7-16(31-3)12-17(18)21(29)30/h4-8,11-12,26H,9-10H2,1-3H3,(H,29,30) |
| InChIKey | RYCVKUCWFFFSJE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_G(1)', 'substructure': 'N/A'} |
|---|