C9H9F3O4 — CID 102523159
2,2,2-trifluoroethyl (1S,2R,4S,5R,6S)-3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylate (PubChem CID 102523159) has the molecular formula C9H9F3O4 and a molecular weight of 238.16 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (1S,2R,4S,5R,6S)-3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl (1S,2R,4S,5R,6S)-3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylate |
|---|---|
| PubChem CID | 102523159 |
| Molecular Formula | C9H9F3O4 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2,2,2-trifluoroethyl (1S,2R,4S,5R,6S)-3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylate |
| SMILES | O=C(OCC(F)(F)F)[C@H]1C[C@@H]2O[C@H]1[C@@H]1O[C@@H]12 |
| InChI | InChI=1S/C9H9F3O4/c10-9(11,12)2-14-8(13)3-1-4-6-7(16-6)5(3)15-4/h3-7H,1-2H2/t3-,4-,5+,6+,7-/m0/s1 |
| InChIKey | GVDLFSSJOJDPFG-TYDWOXHJSA-N |
| XLogP | 0.65 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|