C10H12O6 — CID 134863788
dimethyl (1S,2R,4S,5S,6S,7S)-3,8-dioxatricyclo[3.2.1.02,4]octane-6,7-dicarboxylate (PubChem CID 134863788) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is dimethyl (1S,2R,4S,5S,6S,7S)-3,8-dioxatricyclo[3.2.1.02,4]octane-6,7-dicarboxylate.
| Compound Name | dimethyl (1S,2R,4S,5S,6S,7S)-3,8-dioxatricyclo[3.2.1.02,4]octane-6,7-dicarboxylate |
|---|---|
| PubChem CID | 134863788 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | dimethyl (1S,2R,4S,5S,6S,7S)-3,8-dioxatricyclo[3.2.1.02,4]octane-6,7-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2O[C@H]([C@H]3O[C@H]32)[C@H]1C(=O)OC |
| InChI | InChI=1S/C10H12O6/c1-13-9(11)3-4(10(12)14-2)6-8-7(16-8)5(3)15-6/h3-8H,1-2H3/t3-,4-,5-,6-,7-,8+/m0/s1 |
| InChIKey | KOPDADYGHFEUNL-KVHXAGQOSA-N |
| XLogP | -0.89 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|