C9H10O6 — CID 134866930
(1S,2S,4R,5R,6R,7S)-7-methoxycarbonyl-3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylic acid (PubChem CID 134866930) has the molecular formula C9H10O6 and a molecular weight of 214.17 g/mol. Its IUPAC name is (1S,2S,4R,5R,6R,7S)-7-methoxycarbonyl-3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylic acid.
| Compound Name | (1S,2S,4R,5R,6R,7S)-7-methoxycarbonyl-3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylic acid |
|---|---|
| PubChem CID | 134866930 |
| Molecular Formula | C9H10O6 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (1S,2S,4R,5R,6R,7S)-7-methoxycarbonyl-3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylic acid |
| SMILES | COC(=O)[C@@H]1[C@@H]2O[C@@H]([C@H]3O[C@H]32)[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H10O6/c1-13-9(12)3-2(8(10)11)4-6-7(15-6)5(3)14-4/h2-7H,1H3,(H,10,11)/t2-,3+,4-,5+,6-,7+/m1/s1 |
| InChIKey | ZZPVZAOMBVNSJG-BIWMIDHDSA-N |
| XLogP | -0.98 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|