C9H10O4 — CID 134964617
spiro[3,8-dioxatricyclo[3.2.1.02,4]octane-6,5'-oxolane]-2'-one (PubChem CID 134964617) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is spiro[3,8-dioxatricyclo[3.2.1.02,4]octane-6,5'-oxolane]-2'-one.
| Compound Name | spiro[3,8-dioxatricyclo[3.2.1.02,4]octane-6,5'-oxolane]-2'-one |
|---|---|
| PubChem CID | 134964617 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | spiro[3,8-dioxatricyclo[3.2.1.02,4]octane-6,5'-oxolane]-2'-one |
| SMILES | O=C1CCC2(CC3OC2C2OC32)O1 |
| InChI | InChI=1S/C9H10O4/c10-5-1-2-9(13-5)3-4-6-7(12-6)8(9)11-4/h4,6-8H,1-3H2 |
| InChIKey | NGGBJNGFRVGKAP-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|