C12H18O5 — CID 20662837
3-ethoxypropyl 3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylate (PubChem CID 20662837) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 3-ethoxypropyl 3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylate.
| Compound Name | 3-ethoxypropyl 3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylate |
|---|---|
| PubChem CID | 20662837 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3-ethoxypropyl 3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylate |
| SMILES | CCOCCCOC(=O)C1CC2OC1C1OC21 |
| InChI | InChI=1S/C12H18O5/c1-2-14-4-3-5-15-12(13)7-6-8-10-11(17-10)9(7)16-8/h7-11H,2-6H2,1H3 |
| InChIKey | WFHCWTAMQORUJY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|