C63H42N4O5 — CID 102526302
4-[10,15,20-tris(4-phenoxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 102526302) has the molecular formula C63H42N4O5 and a molecular weight of 935.05 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-phenoxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10,15,20-tris(4-phenoxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 102526302 |
| Molecular Formula | C63H42N4O5 |
| Molecular Weight | 935.05 g/mol |
| Exact Mass | 934.32 |
| IUPAC Name | 4-[10,15,20-tris(4-phenoxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3nc(c(-c4ccc(Oc5ccccc5)cc4)c4ccc([nH]4)c(-c4ccc(Oc5ccccc5)cc4)c4nc(c(-c5ccc(Oc6ccccc6)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C63H42N4O5/c68-63(69)44-18-16-40(17-19-44)59-51-32-34-53(64-51)60(41-20-26-48(27-21-41)70-45-10-4-1-5-11-45)55-36-38-57(66-55)62(43-24-30-50(31-25-43)72-47-14-8-3-9-15-47)58-39-37-56(67-58)61(54-35-33-52(59)65-54)42-22-28-49(29-23-42)71-46-12-6-2-7-13-46/h1-39,64,67H,(H,68,69)/b59-51-,59-52-,60-53-,60-55-,61-54-,61-56-,62-57-,62-58- |
| InChIKey | CMMBRYSHQNYTNR-CKYGRQDQSA-N |
| XLogP | 16.40 |
| TPSA | 122.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.05 |
| LogP ≤ 5 | 16.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |