C21H16BrN3S — CID 102528484
5-(4-bromophenyl)-N,3-diphenyl-6H-1,3,4-thiadiazin-2-imine (PubChem CID 102528484) has the molecular formula C21H16BrN3S and a molecular weight of 422.35 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N,3-diphenyl-6H-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(4-bromophenyl)-N,3-diphenyl-6H-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 102528484 |
| Molecular Formula | C21H16BrN3S |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 5-(4-bromophenyl)-N,3-diphenyl-6H-1,3,4-thiadiazin-2-imine |
| SMILES | Brc1ccc(C2=NN(c3ccccc3)/C(=N/c3ccccc3)SC2)cc1 |
| InChI | InChI=1S/C21H16BrN3S/c22-17-13-11-16(12-14-17)20-15-26-21(23-18-7-3-1-4-8-18)25(24-20)19-9-5-2-6-10-19/h1-14H,15H2/b23-21- |
| InChIKey | JWMWGTPBNVUITF-LNVKXUELSA-N |
| XLogP | 6.09 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|