C25H18BrN2S+ — CID 12773458
3-(4-bromophenyl)-6,8-diphenyl-2H-pyrido[2,1-b][1,3,4]thiadiazin-5-ium (PubChem CID 12773458) has the molecular formula C25H18BrN2S+ and a molecular weight of 458.40 g/mol. Its IUPAC name is 3-(4-bromophenyl)-6,8-diphenyl-2H-pyrido[2,1-b][1,3,4]thiadiazin-5-ium.
| Compound Name | 3-(4-bromophenyl)-6,8-diphenyl-2H-pyrido[2,1-b][1,3,4]thiadiazin-5-ium |
|---|---|
| PubChem CID | 12773458 |
| Molecular Formula | C25H18BrN2S+ |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 3-(4-bromophenyl)-6,8-diphenyl-2H-pyrido[2,1-b][1,3,4]thiadiazin-5-ium |
| SMILES | Brc1ccc(C2=N[n+]3c(cc(-c4ccccc4)cc3-c3ccccc3)SC2)cc1 |
| InChI | InChI=1S/C25H18BrN2S/c26-22-13-11-19(12-14-22)23-17-29-25-16-21(18-7-3-1-4-8-18)15-24(28(25)27-23)20-9-5-2-6-10-20/h1-16H,17H2/q+1 |
| InChIKey | QGIJHVIYBPFHKA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 16.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|