C31H23N2O+ — CID 13112903
6,8-diphenyl-3-(4-phenylphenyl)-2H-pyrido[2,1-b][1,3,4]oxadiazin-5-ium (PubChem CID 13112903) has the molecular formula C31H23N2O+ and a molecular weight of 439.54 g/mol. Its IUPAC name is 6,8-diphenyl-3-(4-phenylphenyl)-2H-pyrido[2,1-b][1,3,4]oxadiazin-5-ium.
| Compound Name | 6,8-diphenyl-3-(4-phenylphenyl)-2H-pyrido[2,1-b][1,3,4]oxadiazin-5-ium |
|---|---|
| PubChem CID | 13112903 |
| Molecular Formula | C31H23N2O+ |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 6,8-diphenyl-3-(4-phenylphenyl)-2H-pyrido[2,1-b][1,3,4]oxadiazin-5-ium |
| SMILES | c1ccc(-c2ccc(C3=N[n+]4c(cc(-c5ccccc5)cc4-c4ccccc4)OC3)cc2)cc1 |
| InChI | InChI=1S/C31H23N2O/c1-4-10-23(11-5-1)25-16-18-26(19-17-25)29-22-34-31-21-28(24-12-6-2-7-13-24)20-30(33(31)32-29)27-14-8-3-9-15-27/h1-21H,22H2/q+1 |
| InChIKey | DJXQGQMJHBXXLI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 25.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|