C20H18N2O3S — CID 102530672
2-[2-(3-benzyl-2-oxo-1,3-thiazolidin-5-yl)ethyl]isoindole-1,3-dione (PubChem CID 102530672) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-[2-(3-benzyl-2-oxo-1,3-thiazolidin-5-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3-benzyl-2-oxo-1,3-thiazolidin-5-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102530672 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-[2-(3-benzyl-2-oxo-1,3-thiazolidin-5-yl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1SC(CCN2C(=O)c3ccccc3C2=O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C20H18N2O3S/c23-18-16-8-4-5-9-17(16)19(24)22(18)11-10-15-13-21(20(25)26-15)12-14-6-2-1-3-7-14/h1-9,15H,10-13H2 |
| InChIKey | PBOMJIUJYMTKIN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|