C13H17NOS — CID 131860745
(5S)-3-benzyl-5-propan-2-yl-1,3-thiazolidin-2-one (PubChem CID 131860745) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is (5S)-3-benzyl-5-propan-2-yl-1,3-thiazolidin-2-one.
| Compound Name | (5S)-3-benzyl-5-propan-2-yl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 131860745 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (5S)-3-benzyl-5-propan-2-yl-1,3-thiazolidin-2-one |
| SMILES | CC(C)[C@H]1CN(Cc2ccccc2)C(=O)S1 |
| InChI | InChI=1S/C13H17NOS/c1-10(2)12-9-14(13(15)16-12)8-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | LOBRDEXKZRCNMO-GFCCVEGCSA-N |
| XLogP | 3.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|