C18H16N6O5S — CID 10253214
(5R,6Z)-6-[(11-ethoxycarbonyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 10253214) has the molecular formula C18H16N6O5S and a molecular weight of 428.43 g/mol. Its IUPAC name is (5R,6Z)-6-[(11-ethoxycarbonyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6Z)-6-[(11-ethoxycarbonyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 10253214 |
| Molecular Formula | C18H16N6O5S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (5R,6Z)-6-[(11-ethoxycarbonyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CCOC(=O)N1CCc2c(cnc3nc(/C=C4/C(=O)N5C(C(=O)O)=CS[C@H]45)nn23)C1 |
| InChI | InChI=1S/C18H16N6O5S/c1-2-29-18(28)22-4-3-11-9(7-22)6-19-17-20-13(21-24(11)17)5-10-14(25)23-12(16(26)27)8-30-15(10)23/h5-6,8,15H,2-4,7H2,1H3,(H,26,27)/b10-5-/t15-/m1/s1 |
| InChIKey | IAUJWOFPTCUPKI-WSVPDTOYSA-N |
| XLogP | 0.86 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|