C12H13N5O3 — CID 87549713
ethyl 4-formyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-11-carboxylate (PubChem CID 87549713) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is ethyl 4-formyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-11-carboxylate.
| Compound Name | ethyl 4-formyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 87549713 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | ethyl 4-formyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-11-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(cnc3nc(C=O)nn23)C1 |
| InChI | InChI=1S/C12H13N5O3/c1-2-20-12(19)16-4-3-9-8(6-16)5-13-11-14-10(7-18)15-17(9)11/h5,7H,2-4,6H2,1H3 |
| InChIKey | YHHXHXVYJGQWEC-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 89.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|