C24H42O3Si — CID 102532565
methyl (2R,3R)-2-tricyclohexylsilyloxolane-3-carboxylate (PubChem CID 102532565) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is methyl (2R,3R)-2-tricyclohexylsilyloxolane-3-carboxylate.
| Compound Name | methyl (2R,3R)-2-tricyclohexylsilyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 102532565 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | methyl (2R,3R)-2-tricyclohexylsilyloxolane-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCO[C@@H]1[Si](C1CCCCC1)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H42O3Si/c1-26-23(25)22-17-18-27-24(22)28(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h19-22,24H,2-18H2,1H3/t22-,24-/m1/s1 |
| InChIKey | OFOHQLIKFYTXSW-ISKFKSNPSA-N |
| XLogP | 6.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|