C7H10F2O3 — CID 99985992
methyl (2S,3R)-2-(difluoromethyl)oxolane-3-carboxylate (PubChem CID 99985992) has the molecular formula C7H10F2O3 and a molecular weight of 180.15 g/mol. Its IUPAC name is methyl (2S,3R)-2-(difluoromethyl)oxolane-3-carboxylate.
| Compound Name | methyl (2S,3R)-2-(difluoromethyl)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 99985992 |
| Molecular Formula | C7H10F2O3 |
| Molecular Weight | 180.15 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | methyl (2S,3R)-2-(difluoromethyl)oxolane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCO[C@@H]1C(F)F |
| InChI | InChI=1S/C7H10F2O3/c1-11-7(10)4-2-3-12-5(4)6(8)9/h4-6H,2-3H2,1H3/t4-,5+/m1/s1 |
| InChIKey | BEGLURATSGTIAO-UHNVWZDZSA-N |
| XLogP | 0.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.15 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |