C11H15F3O3 — CID 129413287
methyl (3aR,4S,6S,7aS)-6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-carboxylate (PubChem CID 129413287) has the molecular formula C11H15F3O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is methyl (3aR,4S,6S,7aS)-6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-carboxylate.
| Compound Name | methyl (3aR,4S,6S,7aS)-6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 129413287 |
| Molecular Formula | C11H15F3O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | methyl (3aR,4S,6S,7aS)-6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H](C(F)(F)F)C[C@@H]2OCC[C@@H]21 |
| InChI | InChI=1S/C11H15F3O3/c1-16-10(15)8-4-6(11(12,13)14)5-9-7(8)2-3-17-9/h6-9H,2-5H2,1H3/t6-,7+,8-,9-/m0/s1 |
| InChIKey | WPTOGFWOFRTAON-KZVJFYERSA-N |
| XLogP | 2.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |