C12H17F3O3 — CID 124676353
methyl (2S,3aR,4R,6S,7aS)-2-methyl-6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-carboxylate (PubChem CID 124676353) has the molecular formula C12H17F3O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is methyl (2S,3aR,4R,6S,7aS)-2-methyl-6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-carboxylate.
| Compound Name | methyl (2S,3aR,4R,6S,7aS)-2-methyl-6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 124676353 |
| Molecular Formula | C12H17F3O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | methyl (2S,3aR,4R,6S,7aS)-2-methyl-6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](C(F)(F)F)C[C@@H]2O[C@@H](C)C[C@@H]21 |
| InChI | InChI=1S/C12H17F3O3/c1-6-3-8-9(11(16)17-2)4-7(12(13,14)15)5-10(8)18-6/h6-10H,3-5H2,1-2H3/t6-,7-,8+,9+,10-/m0/s1 |
| InChIKey | VXJXCKXDICWVST-OEZYJKACSA-N |
| XLogP | 2.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |