C11H14N2 — CID 102533496
4-ethenyl-N,N'-dimethylbenzenecarboximidamide (PubChem CID 102533496) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 4-ethenyl-N,N'-dimethylbenzenecarboximidamide.
| Compound Name | 4-ethenyl-N,N'-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 102533496 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 4-ethenyl-N,N'-dimethylbenzenecarboximidamide |
| SMILES | C=Cc1ccc(/C(=N/C)NC)cc1 |
| InChI | InChI=1S/C11H14N2/c1-4-9-5-7-10(8-6-9)11(12-2)13-3/h4-8H,1H2,2-3H3,(H,12,13) |
| InChIKey | PRLVUTVKAHCJRR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|