C16H14ClFO3S — CID 102533786
S-(4-methoxyphenyl) (2S,3S)-3-(4-chlorophenyl)-2-fluoro-3-hydroxypropanethioate (PubChem CID 102533786) has the molecular formula C16H14ClFO3S and a molecular weight of 340.80 g/mol. Its IUPAC name is S-(4-methoxyphenyl) (2S,3S)-3-(4-chlorophenyl)-2-fluoro-3-hydroxypropanethioate.
| Compound Name | S-(4-methoxyphenyl) (2S,3S)-3-(4-chlorophenyl)-2-fluoro-3-hydroxypropanethioate |
|---|---|
| PubChem CID | 102533786 |
| Molecular Formula | C16H14ClFO3S |
| Molecular Weight | 340.80 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | S-(4-methoxyphenyl) (2S,3S)-3-(4-chlorophenyl)-2-fluoro-3-hydroxypropanethioate |
| SMILES | COc1ccc(SC(=O)[C@@H](F)[C@@H](O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H14ClFO3S/c1-21-12-6-8-13(9-7-12)22-16(20)14(18)15(19)10-2-4-11(17)5-3-10/h2-9,14-15,19H,1H3/t14-,15-/m0/s1 |
| InChIKey | MSZRYNDVOVNVMZ-GJZGRUSLSA-N |
| XLogP | 4.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.80 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|