C11H12N2O3S — CID 102534229
4,5-dimethoxy-1-benzothiophene-2-carbohydrazide (PubChem CID 102534229) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 4,5-dimethoxy-1-benzothiophene-2-carbohydrazide.
| Compound Name | 4,5-dimethoxy-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 102534229 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 4,5-dimethoxy-1-benzothiophene-2-carbohydrazide |
| SMILES | COc1ccc2sc(C(=O)NN)cc2c1OC |
| InChI | InChI=1S/C11H12N2O3S/c1-15-7-3-4-8-6(10(7)16-2)5-9(17-8)11(14)13-12/h3-5H,12H2,1-2H3,(H,13,14) |
| InChIKey | MYGSEZWIRDQOJW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|