C14H18O2S — CID 20747372
2-tert-butyl-4,5-dimethoxy-1-benzothiophene (PubChem CID 20747372) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-tert-butyl-4,5-dimethoxy-1-benzothiophene.
| Compound Name | 2-tert-butyl-4,5-dimethoxy-1-benzothiophene |
|---|---|
| PubChem CID | 20747372 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-tert-butyl-4,5-dimethoxy-1-benzothiophene |
| SMILES | COc1ccc2sc(C(C)(C)C)cc2c1OC |
| InChI | InChI=1S/C14H18O2S/c1-14(2,3)12-8-9-11(17-12)7-6-10(15-4)13(9)16-5/h6-8H,1-5H3 |
| InChIKey | ZEGVAPRQRXVQPL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |