C8H9NS — CID 102544367
5-thiophen-3-yl-3,4-dihydro-2H-pyrrole (PubChem CID 102544367) has the molecular formula C8H9NS and a molecular weight of 151.23 g/mol. Its IUPAC name is 5-thiophen-3-yl-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-thiophen-3-yl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 102544367 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 5-thiophen-3-yl-3,4-dihydro-2H-pyrrole |
| SMILES | c1cc(C2=NCCC2)cs1 |
| InChI | InChI=1S/C8H9NS/c1-2-8(9-4-1)7-3-5-10-6-7/h3,5-6H,1-2,4H2 |
| InChIKey | FTWXUWWOOXMCMZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |