C25H27N7O4 — CID 10254969
1-[3-[[[(cyanoamino)-[[(2S)-oxolan-2-yl]methylamino]methylidene]amino]methyl]phenyl]-3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]urea (PubChem CID 10254969) has the molecular formula C25H27N7O4 and a molecular weight of 489.54 g/mol. Its IUPAC name is 1-[3-[[[(cyanoamino)-[[(2S)-oxolan-2-yl]methylamino]methylidene]amino]methyl]phenyl]-3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]urea.
| Compound Name | 1-[3-[[[(cyanoamino)-[[(2S)-oxolan-2-yl]methylamino]methylidene]amino]methyl]phenyl]-3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 10254969 |
| Molecular Formula | C25H27N7O4 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 1-[3-[[[(cyanoamino)-[[(2S)-oxolan-2-yl]methylamino]methylidene]amino]methyl]phenyl]-3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]urea |
| SMILES | COc1cc(NC(=O)Nc2cccc(C/N=C(\NC#N)NC[C@@H]3CCCO3)c2)ccc1-c1cnco1 |
| InChI | InChI=1S/C25H27N7O4/c1-34-22-11-19(7-8-21(22)23-14-27-16-36-23)32-25(33)31-18-5-2-4-17(10-18)12-28-24(30-15-26)29-13-20-6-3-9-35-20/h2,4-5,7-8,10-11,14,16,20H,3,6,9,12-13H2,1H3,(H2,28,29,30)(H2,31,32,33)/t20-/m0/s1 |
| InChIKey | GPALSZPBAYKALU-FQEVSTJZSA-N |
| XLogP | 3.69 |
| TPSA | 145.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|