C19H16ClN5O2 — CID 10110409
2-[(3-chlorophenyl)methyl]-1-cyano-3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]guanidine (PubChem CID 10110409) has the molecular formula C19H16ClN5O2 and a molecular weight of 381.82 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-1-cyano-3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]guanidine.
| Compound Name | 2-[(3-chlorophenyl)methyl]-1-cyano-3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 10110409 |
| Molecular Formula | C19H16ClN5O2 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-1-cyano-3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]guanidine |
| SMILES | COc1cc(N/C(=N/Cc2cccc(Cl)c2)NC#N)ccc1-c1cnco1 |
| InChI | InChI=1S/C19H16ClN5O2/c1-26-17-8-15(5-6-16(17)18-10-22-12-27-18)25-19(24-11-21)23-9-13-3-2-4-14(20)7-13/h2-8,10,12H,9H2,1H3,(H2,23,24,25) |
| InChIKey | RWCKBEIGFWPOFB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 95.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|